About 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid
3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid (PubChem CID 116838401) has the molecular formula C10H8F2N2O3
and a molecular weight of 242.18 g/mol. Its IUPAC name is 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid.
Molecular Properties
| Compound Name | 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid |
| PubChem CID | 116838401 |
| Molecular Formula | C10H8F2N2O3 |
| Molecular Weight | 242.18 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid |
| SMILES | O=C(O)CC(F)(F)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C10H8F2N2O3/c11-10(12,4-8(15)16)5-1-2-6-7(3-5)14-9(17)13-6/h1-3H,4H2,(H,15,16)(H2,13,14,17) |
| InChIKey | KVHAMKNJJOFEBB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid?
The IUPAC name of 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid (CID 116838401) is 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid.
What is the SMILES notation for 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid?
The canonical SMILES for 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid is O=C(O)CC(F)(F)c1ccc2[nH]c(=O)[nH]c2c1.
What is the InChIKey of 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid?
The InChIKey is KVHAMKNJJOFEBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N2O3/c11-10(12,4-8(15)16)5-1-2-6-7(3-5)14-9(17)13-6/h1-3H,4H2,(H,15,16)(H2,13,14,17).
What are the key properties of 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid?
3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid has a molecular weight of 242.18 g/mol, XLogP of 1.42, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanoic acid is sourced from PubChem (CID 116838401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).