C12H15F2NO — CID 116838573
3-(3,4-dihydro-2H-chromen-6-yl)-3,3-difluoropropan-1-amine (PubChem CID 116838573) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-6-yl)-3,3-difluoropropan-1-amine.
| Compound Name | 3-(3,4-dihydro-2H-chromen-6-yl)-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 116838573 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-6-yl)-3,3-difluoropropan-1-amine |
| SMILES | NCCC(F)(F)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C12H15F2NO/c13-12(14,5-6-15)10-3-4-11-9(8-10)2-1-7-16-11/h3-4,8H,1-2,5-7,15H2 |
| InChIKey | MYGVDBQXOXEECM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |