C12H14ClF2NO — CID 116839056
3-[(5-chloro-2-methoxyphenyl)-difluoromethyl]pyrrolidine (PubChem CID 116839056) has the molecular formula C12H14ClF2NO and a molecular weight of 261.70 g/mol. Its IUPAC name is 3-[(5-chloro-2-methoxyphenyl)-difluoromethyl]pyrrolidine.
| Compound Name | 3-[(5-chloro-2-methoxyphenyl)-difluoromethyl]pyrrolidine |
|---|---|
| PubChem CID | 116839056 |
| Molecular Formula | C12H14ClF2NO |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-[(5-chloro-2-methoxyphenyl)-difluoromethyl]pyrrolidine |
| SMILES | COc1ccc(Cl)cc1C(F)(F)C1CCNC1 |
| InChI | InChI=1S/C12H14ClF2NO/c1-17-11-3-2-9(13)6-10(11)12(14,15)8-4-5-16-7-8/h2-3,6,8,16H,4-5,7H2,1H3 |
| InChIKey | FIJYRTXTOLDTLU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |