About 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine
1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine (PubChem CID 116839328) has the molecular formula C10H12BrF2N
and a molecular weight of 264.11 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine.
Molecular Properties
| Compound Name | 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine |
| PubChem CID | 116839328 |
| Molecular Formula | C10H12BrF2N |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine |
| SMILES | Cc1ccc(Br)cc1C(F)(F)C(C)N |
| InChI | InChI=1S/C10H12BrF2N/c1-6-3-4-8(11)5-9(6)10(12,13)7(2)14/h3-5,7H,14H2,1-2H3 |
| InChIKey | XEGIBVDDPAZHFY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine?
The IUPAC name of 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine (CID 116839328) is 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine.
What is the SMILES notation for 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine?
The canonical SMILES for 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine is Cc1ccc(Br)cc1C(F)(F)C(C)N.
What is the InChIKey of 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine?
The InChIKey is XEGIBVDDPAZHFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrF2N/c1-6-3-4-8(11)5-9(6)10(12,13)7(2)14/h3-5,7H,14H2,1-2H3.
What are the key properties of 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine?
1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine has a molecular weight of 264.11 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-2-methylphenyl)-1,1-difluoropropan-2-amine is sourced from PubChem (CID 116839328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).