C19H17Cl2N3O2S — CID 11683989
N-(3-chloro-4-methoxyphenyl)-2-[2-(4-chlorophenyl)imino-3-methyl-1,3-thiazol-4-yl]acetamide (PubChem CID 11683989) has the molecular formula C19H17Cl2N3O2S and a molecular weight of 422.34 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[2-(4-chlorophenyl)imino-3-methyl-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[2-(4-chlorophenyl)imino-3-methyl-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 11683989 |
| Molecular Formula | C19H17Cl2N3O2S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[2-(4-chlorophenyl)imino-3-methyl-1,3-thiazol-4-yl]acetamide |
| SMILES | COc1ccc(NC(=O)Cc2cs/c(=N\c3ccc(Cl)cc3)n2C)cc1Cl |
| InChI | InChI=1S/C19H17Cl2N3O2S/c1-24-15(11-27-19(24)23-13-5-3-12(20)4-6-13)10-18(25)22-14-7-8-17(26-2)16(21)9-14/h3-9,11H,10H2,1-2H3,(H,22,25)/b23-19- |
| InChIKey | PBGFCCPKKNTJGC-NMWGTECJSA-N |
| XLogP | 4.82 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|