C22H19F6NO3 — CID 11683996
1,1,1,3,3,3-hexafluoro-2-[3-methyl-4-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]phenyl]propan-2-ol (PubChem CID 11683996) has the molecular formula C22H19F6NO3 and a molecular weight of 459.39 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[3-methyl-4-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[3-methyl-4-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 11683996 |
| Molecular Formula | C22H19F6NO3 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[3-methyl-4-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]phenyl]propan-2-ol |
| SMILES | Cc1cccc(-c2nc(COc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3C)c(C)o2)c1 |
| InChI | InChI=1S/C22H19F6NO3/c1-12-5-4-6-15(9-12)19-29-17(14(3)32-19)11-31-18-8-7-16(10-13(18)2)20(30,21(23,24)25)22(26,27)28/h4-10,30H,11H2,1-3H3 |
| InChIKey | VXDVIDUMJDRVTD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |