About [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine
[1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine (PubChem CID 116842404) has the molecular formula C15H22ClNO
and a molecular weight of 267.80 g/mol. Its IUPAC name is [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine.
Molecular Properties
| Compound Name | [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine |
| PubChem CID | 116842404 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine |
| SMILES | COc1c(C)c(C)c(Cl)c(C)c1C1(CN)CC1C |
| InChI | InChI=1S/C15H22ClNO/c1-8-6-15(8,7-17)12-11(4)13(16)9(2)10(3)14(12)18-5/h8H,6-7,17H2,1-5H3 |
| InChIKey | DAHKHCVKQAYSQA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine?
The IUPAC name of [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine (CID 116842404) is [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine.
What is the SMILES notation for [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine?
The canonical SMILES for [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine is COc1c(C)c(C)c(Cl)c(C)c1C1(CN)CC1C.
What is the InChIKey of [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine?
The InChIKey is DAHKHCVKQAYSQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22ClNO/c1-8-6-15(8,7-17)12-11(4)13(16)9(2)10(3)14(12)18-5/h8H,6-7,17H2,1-5H3.
What are the key properties of [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine?
[1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine has a molecular weight of 267.80 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-2-methylcyclopropyl]methanamine is sourced from PubChem (CID 116842404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).