C23H14ClF3N4O2 — CID 11684248
9-chloro-6-(methoxymethyl)-3-[3-(trifluoromethyl)-2-pyridinyl]-12H-quinolino[3,2-c][1,8]naphthyridin-7-one (PubChem CID 11684248) has the molecular formula C23H14ClF3N4O2 and a molecular weight of 470.84 g/mol. Its IUPAC name is 9-chloro-6-(methoxymethyl)-3-[3-(trifluoromethyl)-2-pyridinyl]-12H-quinolino[3,2-c][1,8]naphthyridin-7-one.
| Compound Name | 9-chloro-6-(methoxymethyl)-3-[3-(trifluoromethyl)-2-pyridinyl]-12H-quinolino[3,2-c][1,8]naphthyridin-7-one |
|---|---|
| PubChem CID | 11684248 |
| Molecular Formula | C23H14ClF3N4O2 |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 9-chloro-6-(methoxymethyl)-3-[3-(trifluoromethyl)-2-pyridinyl]-12H-quinolino[3,2-c][1,8]naphthyridin-7-one |
| SMILES | COCc1nc2nc(-c3ncccc3C(F)(F)F)ccc2c2[nH]c3ccc(Cl)cc3c(=O)c12 |
| InChI | InChI=1S/C23H14ClF3N4O2/c1-33-10-17-18-19(29-15-6-4-11(24)9-13(15)21(18)32)12-5-7-16(30-22(12)31-17)20-14(23(25,26)27)3-2-8-28-20/h2-9H,10H2,1H3,(H,29,32) |
| InChIKey | OKSAYRBNSVUQNC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|