C23H24N2O7S — CID 11684276
6-[6-(4-cyano-5-methylcyclopenta-1,3-dien-1-yl)-4,4-dimethyl-2-sulfanylidene-3,1-benzoxazin-1-yl]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 11684276) has the molecular formula C23H24N2O7S and a molecular weight of 472.52 g/mol. Its IUPAC name is 6-[6-(4-cyano-5-methylcyclopenta-1,3-dien-1-yl)-4,4-dimethyl-2-sulfanylidene-3,1-benzoxazin-1-yl]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[6-(4-cyano-5-methylcyclopenta-1,3-dien-1-yl)-4,4-dimethyl-2-sulfanylidene-3,1-benzoxazin-1-yl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 11684276 |
| Molecular Formula | C23H24N2O7S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 6-[6-(4-cyano-5-methylcyclopenta-1,3-dien-1-yl)-4,4-dimethyl-2-sulfanylidene-3,1-benzoxazin-1-yl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC1C(C#N)=CC=C1c1ccc2c(c1)C(C)(C)OC(=S)N2C1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C23H24N2O7S/c1-10-12(9-24)4-6-13(10)11-5-7-15-14(8-11)23(2,3)32-22(33)25(15)20-18(28)16(26)17(27)19(31-20)21(29)30/h4-8,10,16-20,26-28H,1-3H3,(H,29,30) |
| InChIKey | HHZSCWBVBUAULS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|