C12H15BrN2O — CID 116844351
1-(5-bromo-2-methylphenyl)cyclobutane-1-carbohydrazide (PubChem CID 116844351) has the molecular formula C12H15BrN2O and a molecular weight of 283.17 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)cyclobutane-1-carbohydrazide.
| Compound Name | 1-(5-bromo-2-methylphenyl)cyclobutane-1-carbohydrazide |
|---|---|
| PubChem CID | 116844351 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)cyclobutane-1-carbohydrazide |
| SMILES | Cc1ccc(Br)cc1C1(C(=O)NN)CCC1 |
| InChI | InChI=1S/C12H15BrN2O/c1-8-3-4-9(13)7-10(8)12(5-2-6-12)11(16)15-14/h3-4,7H,2,5-6,14H2,1H3,(H,15,16) |
| InChIKey | BFLMAWMETAHIFC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|