C13H20N2O — CID 116845038
N-methyl-3-(2,3,4-trimethylphenyl)propanehydrazide (PubChem CID 116845038) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N-methyl-3-(2,3,4-trimethylphenyl)propanehydrazide.
| Compound Name | N-methyl-3-(2,3,4-trimethylphenyl)propanehydrazide |
|---|---|
| PubChem CID | 116845038 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-methyl-3-(2,3,4-trimethylphenyl)propanehydrazide |
| SMILES | Cc1ccc(CCC(=O)N(C)N)c(C)c1C |
| InChI | InChI=1S/C13H20N2O/c1-9-5-6-12(11(3)10(9)2)7-8-13(16)15(4)14/h5-6H,7-8,14H2,1-4H3 |
| InChIKey | KZESMIXANDNDKJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|