C26H26FN7O2 — CID 11684530
(1R,2R,5R)-2-amino-5-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]oxycyclohexan-1-ol (PubChem CID 11684530) has the molecular formula C26H26FN7O2 and a molecular weight of 487.54 g/mol. Its IUPAC name is (1R,2R,5R)-2-amino-5-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]oxycyclohexan-1-ol.
| Compound Name | (1R,2R,5R)-2-amino-5-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]oxycyclohexan-1-ol |
|---|---|
| PubChem CID | 11684530 |
| Molecular Formula | C26H26FN7O2 |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | (1R,2R,5R)-2-amino-5-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]oxycyclohexan-1-ol |
| SMILES | N[C@@H]1CC[C@@H](Oc2ccn3ncnc(Nc4ccc5c(cnn5Cc5cccc(F)c5)c4)c23)C[C@H]1O |
| InChI | InChI=1S/C26H26FN7O2/c27-18-3-1-2-16(10-18)14-34-22-7-4-19(11-17(22)13-30-34)32-26-25-24(8-9-33(25)31-15-29-26)36-20-5-6-21(28)23(35)12-20/h1-4,7-11,13,15,20-21,23,35H,5-6,12,14,28H2,(H,29,31,32)/t20-,21-,23-/m1/s1 |
| InChIKey | FWIMEDCMGUMLPT-MQSCRBSSSA-N |
| XLogP | 3.63 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |