C14H22N2OS — CID 116847204
N',2-dimethyl-2-(4-propan-2-ylsulfanylphenyl)propanehydrazide (PubChem CID 116847204) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is N',2-dimethyl-2-(4-propan-2-ylsulfanylphenyl)propanehydrazide.
| Compound Name | N',2-dimethyl-2-(4-propan-2-ylsulfanylphenyl)propanehydrazide |
|---|---|
| PubChem CID | 116847204 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N',2-dimethyl-2-(4-propan-2-ylsulfanylphenyl)propanehydrazide |
| SMILES | CNNC(=O)C(C)(C)c1ccc(SC(C)C)cc1 |
| InChI | InChI=1S/C14H22N2OS/c1-10(2)18-12-8-6-11(7-9-12)14(3,4)13(17)16-15-5/h6-10,15H,1-5H3,(H,16,17) |
| InChIKey | HUCGAYZWCBCXQD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|