C15H22N2O2 — CID 116847386
1-(4-methoxy-2,3,6-trimethylphenyl)-N'-methylcyclopropane-1-carbohydrazide (PubChem CID 116847386) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(4-methoxy-2,3,6-trimethylphenyl)-N'-methylcyclopropane-1-carbohydrazide.
| Compound Name | 1-(4-methoxy-2,3,6-trimethylphenyl)-N'-methylcyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 116847386 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(4-methoxy-2,3,6-trimethylphenyl)-N'-methylcyclopropane-1-carbohydrazide |
| SMILES | CNNC(=O)C1(c2c(C)cc(OC)c(C)c2C)CC1 |
| InChI | InChI=1S/C15H22N2O2/c1-9-8-12(19-5)10(2)11(3)13(9)15(6-7-15)14(18)17-16-4/h8,16H,6-7H2,1-5H3,(H,17,18) |
| InChIKey | ZSQDEJQOFGLHOE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|