C16H18N2O — CID 116847390
N'-methyl-1-(6-methylnaphthalen-2-yl)cyclopropane-1-carbohydrazide (PubChem CID 116847390) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is N'-methyl-1-(6-methylnaphthalen-2-yl)cyclopropane-1-carbohydrazide.
| Compound Name | N'-methyl-1-(6-methylnaphthalen-2-yl)cyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 116847390 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N'-methyl-1-(6-methylnaphthalen-2-yl)cyclopropane-1-carbohydrazide |
| SMILES | CNNC(=O)C1(c2ccc3cc(C)ccc3c2)CC1 |
| InChI | InChI=1S/C16H18N2O/c1-11-3-4-13-10-14(6-5-12(13)9-11)16(7-8-16)15(19)18-17-2/h3-6,9-10,17H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | AWOAVHNQVMDELL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|