C11H15BrN2O2 — CID 116847432
2-(3-bromo-4-methoxyphenyl)-N',N'-dimethylacetohydrazide (PubChem CID 116847432) has the molecular formula C11H15BrN2O2 and a molecular weight of 287.16 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-N',N'-dimethylacetohydrazide.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-N',N'-dimethylacetohydrazide |
|---|---|
| PubChem CID | 116847432 |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-N',N'-dimethylacetohydrazide |
| SMILES | COc1ccc(CC(=O)NN(C)C)cc1Br |
| InChI | InChI=1S/C11H15BrN2O2/c1-14(2)13-11(15)7-8-4-5-10(16-3)9(12)6-8/h4-6H,7H2,1-3H3,(H,13,15) |
| InChIKey | GODJLIVKBWPRHL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|