C11H15FN2O2 — CID 116847967
4-ethoxy-3-fluoro-N',N'-dimethylbenzohydrazide (PubChem CID 116847967) has the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. Its IUPAC name is 4-ethoxy-3-fluoro-N',N'-dimethylbenzohydrazide.
| Compound Name | 4-ethoxy-3-fluoro-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 116847967 |
| Molecular Formula | C11H15FN2O2 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-ethoxy-3-fluoro-N',N'-dimethylbenzohydrazide |
| SMILES | CCOc1ccc(C(=O)NN(C)C)cc1F |
| InChI | InChI=1S/C11H15FN2O2/c1-4-16-10-6-5-8(7-9(10)12)11(15)13-14(2)3/h5-7H,4H2,1-3H3,(H,13,15) |
| InChIKey | MIBXDGSPAOOXRZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|