C13H17N3O — CID 116848099
2-(1H-indol-3-yl)-N',N'-dimethylpropanehydrazide (PubChem CID 116848099) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N',N'-dimethylpropanehydrazide.
| Compound Name | 2-(1H-indol-3-yl)-N',N'-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 116848099 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-(1H-indol-3-yl)-N',N'-dimethylpropanehydrazide |
| SMILES | CC(C(=O)NN(C)C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H17N3O/c1-9(13(17)15-16(2)3)11-8-14-12-7-5-4-6-10(11)12/h4-9,14H,1-3H3,(H,15,17) |
| InChIKey | YJAYWOHIUQAYHC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|