About 2-amino-N'-methylpentanehydrazide
2-amino-N'-methylpentanehydrazide (PubChem CID 116849316) has the molecular formula C6H15N3O
and a molecular weight of 145.21 g/mol. Its IUPAC name is 2-amino-N'-methylpentanehydrazide.
Molecular Properties
| Compound Name | 2-amino-N'-methylpentanehydrazide |
| PubChem CID | 116849316 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 2-amino-N'-methylpentanehydrazide |
| SMILES | CCCC(N)C(=O)NNC |
| InChI | InChI=1S/C6H15N3O/c1-3-4-5(7)6(10)9-8-2/h5,8H,3-4,7H2,1-2H3,(H,9,10) |
| InChIKey | IHSSRBKHYYVAQE-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N'-methylpentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N'-methylpentanehydrazide?
The IUPAC name of 2-amino-N'-methylpentanehydrazide (CID 116849316) is 2-amino-N'-methylpentanehydrazide.
What is the SMILES notation for 2-amino-N'-methylpentanehydrazide?
The canonical SMILES for 2-amino-N'-methylpentanehydrazide is CCCC(N)C(=O)NNC.
What is the InChIKey of 2-amino-N'-methylpentanehydrazide?
The InChIKey is IHSSRBKHYYVAQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3O/c1-3-4-5(7)6(10)9-8-2/h5,8H,3-4,7H2,1-2H3,(H,9,10).
What are the key properties of 2-amino-N'-methylpentanehydrazide?
2-amino-N'-methylpentanehydrazide has a molecular weight of 145.21 g/mol, XLogP of -0.64, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N'-methylpentanehydrazide is sourced from PubChem (CID 116849316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).