C12H19N3OS — CID 116849699
3-amino-3-(4-ethylsulfanylphenyl)-N'-methylpropanehydrazide (PubChem CID 116849699) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 3-amino-3-(4-ethylsulfanylphenyl)-N'-methylpropanehydrazide.
| Compound Name | 3-amino-3-(4-ethylsulfanylphenyl)-N'-methylpropanehydrazide |
|---|---|
| PubChem CID | 116849699 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-amino-3-(4-ethylsulfanylphenyl)-N'-methylpropanehydrazide |
| SMILES | CCSc1ccc(C(N)CC(=O)NNC)cc1 |
| InChI | InChI=1S/C12H19N3OS/c1-3-17-10-6-4-9(5-7-10)11(13)8-12(16)15-14-2/h4-7,11,14H,3,8,13H2,1-2H3,(H,15,16) |
| InChIKey | AIKYJLOYLDPOGD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|