C21H18ClF3N2O4S2 — CID 11685005
methyl (2S)-2-amino-3-[4-[4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-(trifluoromethyl)phenoxy]phenyl]propanoate;hydrochloride (PubChem CID 11685005) has the molecular formula C21H18ClF3N2O4S2 and a molecular weight of 518.97 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[4-[4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-(trifluoromethyl)phenoxy]phenyl]propanoate;hydrochloride.
| Compound Name | methyl (2S)-2-amino-3-[4-[4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-(trifluoromethyl)phenoxy]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 11685005 |
| Molecular Formula | C21H18ClF3N2O4S2 |
| Molecular Weight | 518.97 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | methyl (2S)-2-amino-3-[4-[4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-(trifluoromethyl)phenoxy]phenyl]propanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(Oc2ccc(/C=C3\SC(=S)NC3=O)cc2C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C21H17F3N2O4S2.ClH/c1-29-19(28)15(25)9-11-2-5-13(6-3-11)30-16-7-4-12(8-14(16)21(22,23)24)10-17-18(27)26-20(31)32-17;/h2-8,10,15H,9,25H2,1H3,(H,26,27,31);1H/b17-10-;/t15-;/m0./s1 |
| InChIKey | YQHHGZGXVLAADX-LOMISJSESA-N |
| XLogP | 4.45 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.97 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|