C26H32N4O8 — CID 11685139
4-[[4-[[4-[dimethyl(oxido)azaniumyl]oxolan-3-yl]amino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]-N,N-dimethyloxolan-3-amine oxide (PubChem CID 11685139) has the molecular formula C26H32N4O8 and a molecular weight of 528.56 g/mol. Its IUPAC name is 4-[[4-[[4-[dimethyl(oxido)azaniumyl]oxolan-3-yl]amino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]-N,N-dimethyloxolan-3-amine oxide.
| Compound Name | 4-[[4-[[4-[dimethyl(oxido)azaniumyl]oxolan-3-yl]amino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]-N,N-dimethyloxolan-3-amine oxide |
|---|---|
| PubChem CID | 11685139 |
| Molecular Formula | C26H32N4O8 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 4-[[4-[[4-[dimethyl(oxido)azaniumyl]oxolan-3-yl]amino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]-N,N-dimethyloxolan-3-amine oxide |
| SMILES | C[N+](C)([O-])C1COCC1Nc1ccc(NC2COCC2[N+](C)(C)[O-])c2c1C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C26H32N4O8/c1-29(2,35)17-11-37-9-15(17)27-13-5-6-14(28-16-10-38-12-18(16)30(3,4)36)22-21(13)25(33)23-19(31)7-8-20(32)24(23)26(22)34/h5-8,15-18,27-28,31-32H,9-12H2,1-4H3 |
| InChIKey | SJEZNRHRMWTTDJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 163.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|