C11H7NO5 — CID 116851727
methyl 4,5-dioxo-2-pyridin-3-ylfuran-3-carboxylate (PubChem CID 116851727) has the molecular formula C11H7NO5 and a molecular weight of 233.18 g/mol. Its IUPAC name is methyl 4,5-dioxo-2-pyridin-3-ylfuran-3-carboxylate.
| Compound Name | methyl 4,5-dioxo-2-pyridin-3-ylfuran-3-carboxylate |
|---|---|
| PubChem CID | 116851727 |
| Molecular Formula | C11H7NO5 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | methyl 4,5-dioxo-2-pyridin-3-ylfuran-3-carboxylate |
| SMILES | COC(=O)C1=C(c2cccnc2)OC(=O)C1=O |
| InChI | InChI=1S/C11H7NO5/c1-16-10(14)7-8(13)11(15)17-9(7)6-3-2-4-12-5-6/h2-5H,1H3 |
| InChIKey | KZXPAAVXGNKDQM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|