C26H28Cl2N4O2 — CID 11685225
1-N-[4-[2-[bis(2-chloroethyl)amino]ethoxy]acridin-9-yl]-4-methoxybenzene-1,3-diamine (PubChem CID 11685225) has the molecular formula C26H28Cl2N4O2 and a molecular weight of 499.44 g/mol. Its IUPAC name is 1-N-[4-[2-[bis(2-chloroethyl)amino]ethoxy]acridin-9-yl]-4-methoxybenzene-1,3-diamine.
| Compound Name | 1-N-[4-[2-[bis(2-chloroethyl)amino]ethoxy]acridin-9-yl]-4-methoxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 11685225 |
| Molecular Formula | C26H28Cl2N4O2 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 1-N-[4-[2-[bis(2-chloroethyl)amino]ethoxy]acridin-9-yl]-4-methoxybenzene-1,3-diamine |
| SMILES | COc1ccc(Nc2c3ccccc3nc3c(OCCN(CCCl)CCCl)cccc23)cc1N |
| InChI | InChI=1S/C26H28Cl2N4O2/c1-33-23-10-9-18(17-21(23)29)30-25-19-5-2-3-7-22(19)31-26-20(25)6-4-8-24(26)34-16-15-32(13-11-27)14-12-28/h2-10,17H,11-16,29H2,1H3,(H,30,31) |
| InChIKey | QKUMGELWEQEFRA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|