C12H16O3S — CID 116852420
2-(2-methoxy-3,5-dimethylphenyl)sulfanylpropanoic acid (PubChem CID 116852420) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 2-(2-methoxy-3,5-dimethylphenyl)sulfanylpropanoic acid.
| Compound Name | 2-(2-methoxy-3,5-dimethylphenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 116852420 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-(2-methoxy-3,5-dimethylphenyl)sulfanylpropanoic acid |
| SMILES | COc1c(C)cc(C)cc1SC(C)C(=O)O |
| InChI | InChI=1S/C12H16O3S/c1-7-5-8(2)11(15-4)10(6-7)16-9(3)12(13)14/h5-6,9H,1-4H3,(H,13,14) |
| InChIKey | NGNJXIKPMNEKIY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |