C24H35N2O3S2+ — CID 11685326
[(1S,5R)-8-(6-hydroxyhexyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-thiophen-3-yl-N-(thiophen-3-ylmethyl)carbamate (PubChem CID 11685326) has the molecular formula C24H35N2O3S2+ and a molecular weight of 463.69 g/mol. Its IUPAC name is [(1S,5R)-8-(6-hydroxyhexyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-thiophen-3-yl-N-(thiophen-3-ylmethyl)carbamate.
| Compound Name | [(1S,5R)-8-(6-hydroxyhexyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-thiophen-3-yl-N-(thiophen-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 11685326 |
| Molecular Formula | C24H35N2O3S2+ |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | [(1S,5R)-8-(6-hydroxyhexyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-thiophen-3-yl-N-(thiophen-3-ylmethyl)carbamate |
| SMILES | C[N+]1(CCCCCCO)[C@@H]2CC[C@H]1CC(OC(=O)N(Cc1ccsc1)c1ccsc1)C2 |
| InChI | InChI=1S/C24H35N2O3S2/c1-26(10-4-2-3-5-11-27)21-6-7-22(26)15-23(14-21)29-24(28)25(20-9-13-31-18-20)16-19-8-12-30-17-19/h8-9,12-13,17-18,21-23,27H,2-7,10-11,14-16H2,1H3/q+1/t21-,22+,23?,26? |
| InChIKey | GEXWLUQPAHJCMQ-RYVCDLKSSA-N |
| XLogP | 5.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|