C14H23NOS — CID 116853493
2-(4-methoxy-3-propan-2-ylphenyl)sulfanyl-2-methylpropan-1-amine (PubChem CID 116853493) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is 2-(4-methoxy-3-propan-2-ylphenyl)sulfanyl-2-methylpropan-1-amine.
| Compound Name | 2-(4-methoxy-3-propan-2-ylphenyl)sulfanyl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 116853493 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-(4-methoxy-3-propan-2-ylphenyl)sulfanyl-2-methylpropan-1-amine |
| SMILES | COc1ccc(SC(C)(C)CN)cc1C(C)C |
| InChI | InChI=1S/C14H23NOS/c1-10(2)12-8-11(6-7-13(12)16-5)17-14(3,4)9-15/h6-8,10H,9,15H2,1-5H3 |
| InChIKey | VHXOZTKWJPOTGB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |