C34H41N7 — CID 11685364
N-benzyl-2-[4-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]imidazol-1-yl]ethanamine (PubChem CID 11685364) has the molecular formula C34H41N7 and a molecular weight of 547.75 g/mol. Its IUPAC name is N-benzyl-2-[4-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]imidazol-1-yl]ethanamine.
| Compound Name | N-benzyl-2-[4-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]imidazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 11685364 |
| Molecular Formula | C34H41N7 |
| Molecular Weight | 547.75 g/mol |
| Exact Mass | 547.34 |
| IUPAC Name | N-benzyl-2-[4-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]imidazol-1-yl]ethanamine |
| SMILES | CC(C)(C)c1ccc(-c2nc3c(N4CCN(Cc5cn(CCNCc6ccccc6)cn5)CC4)cccc3[nH]2)cc1 |
| InChI | InChI=1S/C34H41N7/c1-34(2,3)28-14-12-27(13-15-28)33-37-30-10-7-11-31(32(30)38-33)41-20-18-39(19-21-41)23-29-24-40(25-36-29)17-16-35-22-26-8-5-4-6-9-26/h4-15,24-25,35H,16-23H2,1-3H3,(H,37,38) |
| InChIKey | KWVQNZQYRPEBBK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.75 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|