C15H15N3O — CID 116854288
6-(2-methoxy-4,6-dimethylphenyl)imidazo[1,2-b]pyridazine (PubChem CID 116854288) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 6-(2-methoxy-4,6-dimethylphenyl)imidazo[1,2-b]pyridazine.
| Compound Name | 6-(2-methoxy-4,6-dimethylphenyl)imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 116854288 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 6-(2-methoxy-4,6-dimethylphenyl)imidazo[1,2-b]pyridazine |
| SMILES | COc1cc(C)cc(C)c1-c1ccc2nccn2n1 |
| InChI | InChI=1S/C15H15N3O/c1-10-8-11(2)15(13(9-10)19-3)12-4-5-14-16-6-7-18(14)17-12/h4-9H,1-3H3 |
| InChIKey | SMCQUXWSBYRTAU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |