About 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide
4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide (PubChem CID 1168553) has the molecular formula C13H16N2O4S3
and a molecular weight of 360.48 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide.
Molecular Properties
| Compound Name | 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide |
| PubChem CID | 1168553 |
| Molecular Formula | C13H16N2O4S3 |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(S(=O)(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C13H16N2O4S3/c1-15(2)22(18,19)13-7-5-12(6-8-13)21(16,17)14-10-11-4-3-9-20-11/h3-9,14H,10H2,1-2H3 |
| InChIKey | GEBJFAVRTRYHBI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide?
The IUPAC name of 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide (CID 1168553) is 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide.
What is the SMILES notation for 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide?
The canonical SMILES for 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide is CN(C)S(=O)(=O)c1ccc(S(=O)(=O)NCc2cccs2)cc1.
What is the InChIKey of 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide?
The InChIKey is GEBJFAVRTRYHBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4S3/c1-15(2)22(18,19)13-7-5-12(6-8-13)21(16,17)14-10-11-4-3-9-20-11/h3-9,14H,10H2,1-2H3.
What are the key properties of 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide?
4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide has a molecular weight of 360.48 g/mol, XLogP of 1.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-dimethyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-disulfonamide is sourced from PubChem (CID 1168553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).