C11H10F2O2S — CID 116855431
1-(2,5-difluorophenyl)sulfanylcyclobutane-1-carboxylic acid (PubChem CID 116855431) has the molecular formula C11H10F2O2S and a molecular weight of 244.26 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfanylcyclobutane-1-carboxylic acid.
| Compound Name | 1-(2,5-difluorophenyl)sulfanylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 116855431 |
| Molecular Formula | C11H10F2O2S |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfanylcyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(Sc2cc(F)ccc2F)CCC1 |
| InChI | InChI=1S/C11H10F2O2S/c12-7-2-3-8(13)9(6-7)16-11(10(14)15)4-1-5-11/h2-3,6H,1,4-5H2,(H,14,15) |
| InChIKey | QETJDIFSGHLLKC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |