C15H26N2 — CID 116855593
2-(4-tert-butyl-2,6-dimethylphenyl)propane-1,2-diamine (PubChem CID 116855593) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-(4-tert-butyl-2,6-dimethylphenyl)propane-1,2-diamine.
| Compound Name | 2-(4-tert-butyl-2,6-dimethylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 116855593 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 2-(4-tert-butyl-2,6-dimethylphenyl)propane-1,2-diamine |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(C)(N)CN |
| InChI | InChI=1S/C15H26N2/c1-10-7-12(14(3,4)5)8-11(2)13(10)15(6,17)9-16/h7-8H,9,16-17H2,1-6H3 |
| InChIKey | IVPVMGCHTITMER-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |