About 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine
2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine (PubChem CID 116856365) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine.
Molecular Properties
| Compound Name | 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine |
| PubChem CID | 116856365 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine |
| SMILES | COc1c(C)c(C)cc(C)c1C1(C)CNCCN1 |
| InChI | InChI=1S/C15H24N2O/c1-10-8-11(2)13(14(18-5)12(10)3)15(4)9-16-6-7-17-15/h8,16-17H,6-7,9H2,1-5H3 |
| InChIKey | PFHRBLVMBNQEPZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine?
The IUPAC name of 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine (CID 116856365) is 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine.
What is the SMILES notation for 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine?
The canonical SMILES for 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine is COc1c(C)c(C)cc(C)c1C1(C)CNCCN1.
What is the InChIKey of 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine?
The InChIKey is PFHRBLVMBNQEPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O/c1-10-8-11(2)13(14(18-5)12(10)3)15(4)9-16-6-7-17-15/h8,16-17H,6-7,9H2,1-5H3.
What are the key properties of 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine?
2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine has a molecular weight of 248.37 g/mol, XLogP of 2.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxy-3,4,6-trimethylphenyl)-2-methylpiperazine is sourced from PubChem (CID 116856365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).