C12H16F2N2 — CID 116856393
2-(2,5-difluorophenyl)-1,4-dimethylpiperazine (PubChem CID 116856393) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1,4-dimethylpiperazine.
| Compound Name | 2-(2,5-difluorophenyl)-1,4-dimethylpiperazine |
|---|---|
| PubChem CID | 116856393 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1,4-dimethylpiperazine |
| SMILES | CN1CCN(C)C(c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C12H16F2N2/c1-15-5-6-16(2)12(8-15)10-7-9(13)3-4-11(10)14/h3-4,7,12H,5-6,8H2,1-2H3 |
| InChIKey | CKWAEPUNGBNPFK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |