About 2-(2-bromophenyl)-1,2,4-trimethylpiperazine
2-(2-bromophenyl)-1,2,4-trimethylpiperazine (PubChem CID 116856569) has the molecular formula C13H19BrN2
and a molecular weight of 283.21 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1,2,4-trimethylpiperazine.
Molecular Properties
| Compound Name | 2-(2-bromophenyl)-1,2,4-trimethylpiperazine |
| PubChem CID | 116856569 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-(2-bromophenyl)-1,2,4-trimethylpiperazine |
| SMILES | CN1CCN(C)C(C)(c2ccccc2Br)C1 |
| InChI | InChI=1S/C13H19BrN2/c1-13(10-15(2)8-9-16(13)3)11-6-4-5-7-12(11)14/h4-7H,8-10H2,1-3H3 |
| InChIKey | QCPQWQMSJJIPTO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-bromophenyl)-1,2,4-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenyl)-1,2,4-trimethylpiperazine?
The IUPAC name of 2-(2-bromophenyl)-1,2,4-trimethylpiperazine (CID 116856569) is 2-(2-bromophenyl)-1,2,4-trimethylpiperazine.
What is the SMILES notation for 2-(2-bromophenyl)-1,2,4-trimethylpiperazine?
The canonical SMILES for 2-(2-bromophenyl)-1,2,4-trimethylpiperazine is CN1CCN(C)C(C)(c2ccccc2Br)C1.
What is the InChIKey of 2-(2-bromophenyl)-1,2,4-trimethylpiperazine?
The InChIKey is QCPQWQMSJJIPTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrN2/c1-13(10-15(2)8-9-16(13)3)11-6-4-5-7-12(11)14/h4-7H,8-10H2,1-3H3.
What are the key properties of 2-(2-bromophenyl)-1,2,4-trimethylpiperazine?
2-(2-bromophenyl)-1,2,4-trimethylpiperazine has a molecular weight of 283.21 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenyl)-1,2,4-trimethylpiperazine is sourced from PubChem (CID 116856569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).