About 5-(3-bromophenyl)-1,3-dimethylpyrazole
5-(3-bromophenyl)-1,3-dimethylpyrazole (PubChem CID 116856814) has the molecular formula C11H11BrN2
and a molecular weight of 251.13 g/mol. Its IUPAC name is 5-(3-bromophenyl)-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-(3-bromophenyl)-1,3-dimethylpyrazole |
| PubChem CID | 116856814 |
| Molecular Formula | C11H11BrN2 |
| Molecular Weight | 251.13 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 5-(3-bromophenyl)-1,3-dimethylpyrazole |
| SMILES | Cc1cc(-c2cccc(Br)c2)n(C)n1 |
| InChI | InChI=1S/C11H11BrN2/c1-8-6-11(14(2)13-8)9-4-3-5-10(12)7-9/h3-7H,1-2H3 |
| InChIKey | WSUWGOIASVGLKI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.13 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3-bromophenyl)-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-bromophenyl)-1,3-dimethylpyrazole?
The IUPAC name of 5-(3-bromophenyl)-1,3-dimethylpyrazole (CID 116856814) is 5-(3-bromophenyl)-1,3-dimethylpyrazole.
What is the SMILES notation for 5-(3-bromophenyl)-1,3-dimethylpyrazole?
The canonical SMILES for 5-(3-bromophenyl)-1,3-dimethylpyrazole is Cc1cc(-c2cccc(Br)c2)n(C)n1.
What is the InChIKey of 5-(3-bromophenyl)-1,3-dimethylpyrazole?
The InChIKey is WSUWGOIASVGLKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2/c1-8-6-11(14(2)13-8)9-4-3-5-10(12)7-9/h3-7H,1-2H3.
What are the key properties of 5-(3-bromophenyl)-1,3-dimethylpyrazole?
5-(3-bromophenyl)-1,3-dimethylpyrazole has a molecular weight of 251.13 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-bromophenyl)-1,3-dimethylpyrazole is sourced from PubChem (CID 116856814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).