C8H12BrNOS — CID 116857267
2-(4-bromothiophen-2-yl)-2-(dimethylamino)ethanol (PubChem CID 116857267) has the molecular formula C8H12BrNOS and a molecular weight of 250.16 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-2-(dimethylamino)ethanol.
| Compound Name | 2-(4-bromothiophen-2-yl)-2-(dimethylamino)ethanol |
|---|---|
| PubChem CID | 116857267 |
| Molecular Formula | C8H12BrNOS |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-2-(dimethylamino)ethanol |
| SMILES | CN(C)C(CO)c1cc(Br)cs1 |
| InChI | InChI=1S/C8H12BrNOS/c1-10(2)7(4-11)8-3-6(9)5-12-8/h3,5,7,11H,4H2,1-2H3 |
| InChIKey | ONZHRTVCPGQKGT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |