About 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid
4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 116858095) has the molecular formula C11H6BrN3O4
and a molecular weight of 324.09 g/mol. Its IUPAC name is 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 116858095 |
| Molecular Formula | C11H6BrN3O4 |
| Molecular Weight | 324.09 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1noc(-c2ccc3[nH]c(=O)[nH]c3c2)c1Br |
| InChI | InChI=1S/C11H6BrN3O4/c12-7-8(10(16)17)15-19-9(7)4-1-2-5-6(3-4)14-11(18)13-5/h1-3H,(H,16,17)(H2,13,14,18) |
| InChIKey | ASZHOBPLPYGZHO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.09 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid (CID 116858095) is 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1noc(-c2ccc3[nH]c(=O)[nH]c3c2)c1Br.
What is the InChIKey of 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is ASZHOBPLPYGZHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6BrN3O4/c12-7-8(10(16)17)15-19-9(7)4-1-2-5-6(3-4)14-11(18)13-5/h1-3H,(H,16,17)(H2,13,14,18).
What are the key properties of 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid?
4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 324.09 g/mol, XLogP of 1.97, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 116858095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).