About 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile
5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile (PubChem CID 116858929) has the molecular formula C11H6N4O2
and a molecular weight of 226.20 g/mol. Its IUPAC name is 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile |
| PubChem CID | 116858929 |
| Molecular Formula | C11H6N4O2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile |
| SMILES | N#Cc1cc(-c2ccc3[nH]c(=O)[nH]c3c2)on1 |
| InChI | InChI=1S/C11H6N4O2/c12-5-7-4-10(17-15-7)6-1-2-8-9(3-6)14-11(16)13-8/h1-4H,(H2,13,14,16) |
| InChIKey | UOYGDAGXFOHPJE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile?
The IUPAC name of 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile (CID 116858929) is 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile.
What is the SMILES notation for 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile?
The canonical SMILES for 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile is N#Cc1cc(-c2ccc3[nH]c(=O)[nH]c3c2)on1.
What is the InChIKey of 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile?
The InChIKey is UOYGDAGXFOHPJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N4O2/c12-5-7-4-10(17-15-7)6-1-2-8-9(3-6)14-11(16)13-8/h1-4H,(H2,13,14,16).
What are the key properties of 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile?
5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile has a molecular weight of 226.20 g/mol, XLogP of 1.38, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-1,2-oxazole-3-carbonitrile is sourced from PubChem (CID 116858929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).