About 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile
4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile (PubChem CID 116859018) has the molecular formula C16H15BrN2O
and a molecular weight of 331.21 g/mol. Its IUPAC name is 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile.
Molecular Properties
| Compound Name | 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile |
| PubChem CID | 116859018 |
| Molecular Formula | C16H15BrN2O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile |
| SMILES | N#Cc1noc(-c2ccc(C3CCCCC3)cc2)c1Br |
| InChI | InChI=1S/C16H15BrN2O/c17-15-14(10-18)19-20-16(15)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h6-9,11H,1-5H2 |
| InChIKey | FAULQZNYSOONTM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile?
The IUPAC name of 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile (CID 116859018) is 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile.
What is the SMILES notation for 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile?
The canonical SMILES for 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile is N#Cc1noc(-c2ccc(C3CCCCC3)cc2)c1Br.
What is the InChIKey of 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile?
The InChIKey is FAULQZNYSOONTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrN2O/c17-15-14(10-18)19-20-16(15)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h6-9,11H,1-5H2.
What are the key properties of 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile?
4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile has a molecular weight of 331.21 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-(4-cyclohexylphenyl)-1,2-oxazole-3-carbonitrile is sourced from PubChem (CID 116859018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).