methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate

C15H19NO3 — CID 116860571

IUPACmethyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate
SMILESCOC(=O)C(NC(C)=O)c1ccc2c(c1)CCCC2
InChIInChI=1S/C15H19NO3/c1-10(17)16-14(15(18)19-2)13-8-7-11-5-3-4-6-12(11)9-13/h7-9,14H,3-6H2,1-2H3,(H,16,17)
InChIKeyLCBLREFUPJPKBY-UHFFFAOYSA-N
MW261.32 g/mol
LogP1.92
Rot. Bonds3

About methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate

methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate (PubChem CID 116860571) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate.

Molecular Properties

Compound Namemethyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate
PubChem CID116860571
Molecular FormulaC15H19NO3
Molecular Weight261.32 g/mol
Exact Mass261.14
IUPAC Namemethyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate
SMILESCOC(=O)C(NC(C)=O)c1ccc2c(c1)CCCC2
InChIInChI=1S/C15H19NO3/c1-10(17)16-14(15(18)19-2)13-8-7-11-5-3-4-6-12(11)9-13/h7-9,14H,3-6H2,1-2H3,(H,16,17)
InChIKeyLCBLREFUPJPKBY-UHFFFAOYSA-N
XLogP1.92
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.32
LogP ≤ 51.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate?
The IUPAC name of methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate (CID 116860571) is methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate.
What is the SMILES notation for methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate?
The canonical SMILES for methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate is COC(=O)C(NC(C)=O)c1ccc2c(c1)CCCC2.
What is the InChIKey of methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate?
The InChIKey is LCBLREFUPJPKBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-10(17)16-14(15(18)19-2)13-8-7-11-5-3-4-6-12(11)9-13/h7-9,14H,3-6H2,1-2H3,(H,16,17).
What are the key properties of methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate?
methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate has a molecular weight of 261.32 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetate is sourced from PubChem (CID 116860571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).