C29H34BrCl3N2O6 — CID 11686232
3-(4-bromo-2,6-dimethylphenyl)-3-chloro-8-methoxy-1-azaspiro[4.5]decane-2,4-dione;2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone (PubChem CID 11686232) has the molecular formula C29H34BrCl3N2O6 and a molecular weight of 692.86 g/mol. Its IUPAC name is 3-(4-bromo-2,6-dimethylphenyl)-3-chloro-8-methoxy-1-azaspiro[4.5]decane-2,4-dione;2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone.
| Compound Name | 3-(4-bromo-2,6-dimethylphenyl)-3-chloro-8-methoxy-1-azaspiro[4.5]decane-2,4-dione;2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 11686232 |
| Molecular Formula | C29H34BrCl3N2O6 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 690.07 |
| IUPAC Name | 3-(4-bromo-2,6-dimethylphenyl)-3-chloro-8-methoxy-1-azaspiro[4.5]decane-2,4-dione;2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone |
| SMILES | CC1(C)OC(c2ccco2)CN1C(=O)C(Cl)Cl.COC1CCC2(CC1)NC(=O)C(Cl)(c1c(C)cc(Br)cc1C)C2=O |
| InChI | InChI=1S/C18H21BrClNO3.C11H13Cl2NO3/c1-10-8-12(19)9-11(2)14(10)18(20)15(22)17(21-16(18)23)6-4-13(24-3)5-7-17;1-11(2)14(10(15)9(12)13)6-8(17-11)7-4-3-5-16-7/h8-9,13H,4-7H2,1-3H3,(H,21,23);3-5,8-9H,6H2,1-2H3 |
| InChIKey | CVENALMYSDEUPA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|