C9H12N4 — CID 116862607
6-amino-2-(2-methylpropyl)pyrimidine-4-carbonitrile (PubChem CID 116862607) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 6-amino-2-(2-methylpropyl)pyrimidine-4-carbonitrile.
| Compound Name | 6-amino-2-(2-methylpropyl)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 116862607 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 6-amino-2-(2-methylpropyl)pyrimidine-4-carbonitrile |
| SMILES | CC(C)Cc1nc(N)cc(C#N)n1 |
| InChI | InChI=1S/C9H12N4/c1-6(2)3-9-12-7(5-10)4-8(11)13-9/h4,6H,3H2,1-2H3,(H2,11,12,13) |
| InChIKey | DMAYFRZBWSJTET-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |