C15H10N4 — CID 116862729
6-amino-2-naphthalen-1-ylpyrimidine-4-carbonitrile (PubChem CID 116862729) has the molecular formula C15H10N4 and a molecular weight of 246.27 g/mol. Its IUPAC name is 6-amino-2-naphthalen-1-ylpyrimidine-4-carbonitrile.
| Compound Name | 6-amino-2-naphthalen-1-ylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 116862729 |
| Molecular Formula | C15H10N4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 6-amino-2-naphthalen-1-ylpyrimidine-4-carbonitrile |
| SMILES | N#Cc1cc(N)nc(-c2cccc3ccccc23)n1 |
| InChI | InChI=1S/C15H10N4/c16-9-11-8-14(17)19-15(18-11)13-7-3-5-10-4-1-2-6-12(10)13/h1-8H,(H2,17,18,19) |
| InChIKey | XOWPRXBWBFNKER-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |