About 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane
3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane (PubChem CID 116864078) has the molecular formula C10H10ClFO
and a molecular weight of 200.64 g/mol. Its IUPAC name is 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane.
Molecular Properties
| Compound Name | 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane |
| PubChem CID | 116864078 |
| Molecular Formula | C10H10ClFO |
| Molecular Weight | 200.64 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane |
| SMILES | CC1(C)OC1c1cc(Cl)ccc1F |
| InChI | InChI=1S/C10H10ClFO/c1-10(2)9(13-10)7-5-6(11)3-4-8(7)12/h3-5,9H,1-2H3 |
| InChIKey | IHRSBEPWKOHZJI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.64 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane?
The IUPAC name of 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane (CID 116864078) is 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane.
What is the SMILES notation for 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane?
The canonical SMILES for 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane is CC1(C)OC1c1cc(Cl)ccc1F.
What is the InChIKey of 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane?
The InChIKey is IHRSBEPWKOHZJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClFO/c1-10(2)9(13-10)7-5-6(11)3-4-8(7)12/h3-5,9H,1-2H3.
What are the key properties of 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane?
3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane has a molecular weight of 200.64 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-2-fluorophenyl)-2,2-dimethyloxirane is sourced from PubChem (CID 116864078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).