About 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole
5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole (PubChem CID 116864122) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole |
| PubChem CID | 116864122 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole |
| SMILES | Cc1cc2c(cc1C1OC1(C)C)OCO2 |
| InChI | InChI=1S/C12H14O3/c1-7-4-9-10(14-6-13-9)5-8(7)11-12(2,3)15-11/h4-5,11H,6H2,1-3H3 |
| InChIKey | KMPGKYPKLDQSLI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole?
The IUPAC name of 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole (CID 116864122) is 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole.
What is the SMILES notation for 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole?
The canonical SMILES for 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole is Cc1cc2c(cc1C1OC1(C)C)OCO2.
What is the InChIKey of 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole?
The InChIKey is KMPGKYPKLDQSLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-7-4-9-10(14-6-13-9)5-8(7)11-12(2,3)15-11/h4-5,11H,6H2,1-3H3.
What are the key properties of 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole?
5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole has a molecular weight of 206.24 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-dimethyloxiran-2-yl)-6-methyl-1,3-benzodioxole is sourced from PubChem (CID 116864122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).