C11H12ClFO — CID 116864142
3-(2-chloro-5-fluoro-4-methylphenyl)-2,2-dimethyloxirane (PubChem CID 116864142) has the molecular formula C11H12ClFO and a molecular weight of 214.67 g/mol. Its IUPAC name is 3-(2-chloro-5-fluoro-4-methylphenyl)-2,2-dimethyloxirane.
| Compound Name | 3-(2-chloro-5-fluoro-4-methylphenyl)-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 116864142 |
| Molecular Formula | C11H12ClFO |
| Molecular Weight | 214.67 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-(2-chloro-5-fluoro-4-methylphenyl)-2,2-dimethyloxirane |
| SMILES | Cc1cc(Cl)c(C2OC2(C)C)cc1F |
| InChI | InChI=1S/C11H12ClFO/c1-6-4-8(12)7(5-9(6)13)10-11(2,3)14-10/h4-5,10H,1-3H3 |
| InChIKey | YRZJHLPLUASUBD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|