C14H10N2O3 — CID 116864671
2-(1,3-benzodioxol-5-yl)-5-methoxypyridine-4-carbonitrile (PubChem CID 116864671) has the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-methoxypyridine-4-carbonitrile.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-methoxypyridine-4-carbonitrile |
|---|---|
| PubChem CID | 116864671 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-methoxypyridine-4-carbonitrile |
| SMILES | COc1cnc(-c2ccc3c(c2)OCO3)cc1C#N |
| InChI | InChI=1S/C14H10N2O3/c1-17-14-7-16-11(4-10(14)6-15)9-2-3-12-13(5-9)19-8-18-12/h2-5,7H,8H2,1H3 |
| InChIKey | FNBDAJNUKCZPOK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |