C13H14ClNO3 — CID 116864869
2-(5-chloro-2-methoxy-4-methylphenyl)-5-ethoxy-1,3-oxazole (PubChem CID 116864869) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-4-methylphenyl)-5-ethoxy-1,3-oxazole.
| Compound Name | 2-(5-chloro-2-methoxy-4-methylphenyl)-5-ethoxy-1,3-oxazole |
|---|---|
| PubChem CID | 116864869 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-(5-chloro-2-methoxy-4-methylphenyl)-5-ethoxy-1,3-oxazole |
| SMILES | CCOc1cnc(-c2cc(Cl)c(C)cc2OC)o1 |
| InChI | InChI=1S/C13H14ClNO3/c1-4-17-12-7-15-13(18-12)9-6-10(14)8(2)5-11(9)16-3/h5-7H,4H2,1-3H3 |
| InChIKey | BWBYKATYESRDCL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |