About 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid
6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid (PubChem CID 116865013) has the molecular formula C14H14N2O3
and a molecular weight of 258.28 g/mol. Its IUPAC name is 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid |
| PubChem CID | 116865013 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid |
| SMILES | Cc1cc(C)c(-c2ncc(C(=O)O)c(=O)[nH]2)cc1C |
| InChI | InChI=1S/C14H14N2O3/c1-7-4-9(3)10(5-8(7)2)12-15-6-11(14(18)19)13(17)16-12/h4-6H,1-3H3,(H,18,19)(H,15,16,17) |
| InChIKey | JHLXTEXTLNOBID-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid?
The IUPAC name of 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid (CID 116865013) is 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid.
What is the SMILES notation for 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid?
The canonical SMILES for 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid is Cc1cc(C)c(-c2ncc(C(=O)O)c(=O)[nH]2)cc1C.
What is the InChIKey of 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid?
The InChIKey is JHLXTEXTLNOBID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3/c1-7-4-9(3)10(5-8(7)2)12-15-6-11(14(18)19)13(17)16-12/h4-6H,1-3H3,(H,18,19)(H,15,16,17).
What are the key properties of 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid?
6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid has a molecular weight of 258.28 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-2-(2,4,5-trimethylphenyl)-1H-pyrimidine-5-carboxylic acid is sourced from PubChem (CID 116865013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).